CAS No.: | 123312-89-0 |
---|---|
Formula: | C10h11n5o |
Appearance: | Powder |
Source: | Organic Synthesis |
Transport Package: | Customized |
Specification: | Customized |
Samples: |
---|
Customization: |
---|
Suppliers with verified business licenses
Isomerism | Isomeric |
Chemical formula | C10H11N5O |
Canonical SMILES | CC1=NNC(=O)N(C1)N=CC2=CN=CC=C2 |
Isomeric SMILES | CC1=NNC(=O)N(C1)/N=C/C2=CN=CC=C2 |
International Chemical Identifier key (InChIKey) | QHMTXANCGGJZRX-WUXMJOGZSA-N |
International Chemical Identifier (InChI) | InChI=1S/C10H11N5O/c1-8-7-15(10(16)14-13-8)12-6-9-3-2-4-11-5-9/h2-6H,7H2,1H3,(H,14,16)/b12-6+ |
Pesticide type | Insecticide |
Substance group | Pyridine |
Minimum active substance purity | 970 g/kg |
Known relevant impurities | EU dossier - None declared |
Substance origin | Synthetic |
Mode of action | Selective, neural inhibition of feeding behavior that eventually starves insect. |
CAS RN | 123312-89-0 |
EC number | - |
CIPAC number | 593 |
US EPA chemical code | 101103 |
PubChem CID | 9576037 |
Molecular mass (g mol-1) | 217.23 |
PIN (Preferred Identification Name) | - |
IUPAC name | (E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one |
CAS name | 4,5-dihydro-6-methyl-4-((E)-(3-pyridinylmethylene)amino)-1,2,4-triazin-3(2H)-one |
Suppliers with verified business licenses