|
Still deciding? Get samples of $ !
Request Sample
|
| Customization: | Available |
|---|---|
| CAS No.: | 104206-82-8 |
| Formula: | C14h13no7s |
Suppliers with verified business licenses
Audited by an independent third-party inspection agency
| Isomerism | None |
| Chemical formula | C14H13NO7S |
| Canonical SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)C2C(=O)CCCC2=O)[N+](=O)[O-] |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | KPUREKXXPHOJQT-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C14H13NO7S/c1-23(21,22)8-5-6-9(10(7-8)15(19)20)14(18)13-11(16)3-2-4-12(13)17/h5-7,13H,2-4H2,1H3 |
| Pesticide type | Herbicide |
| Substance group | Triketone |
| Minimum active substance purity | 930 g/kg |
| Known relevant impurities | EU dossier (2016) - 1-cyano-6-(methylsulfonyl)-7-nitro-9H-xanthen-9-one <2 mg/kg; 6-(methylsulfonyl)-9-oxo-9H-xanthene-1- carbonitrile <2 g/kg; 1,2-dichloroethane <1 g/kg |
| Substance origin | Synthetic |
| Mode of action | Selective, absorbed by roots and translocated. Bleaching: inhibition of 4-hydroxyphenyl-pyruvate-dioxygenase. |
| CAS RN | 104206-82-8 |
| EC number | 609-064-00 |
| CIPAC number | 625 |
| US EPA chemical code | 122990 |
| PubChem CID | 175967 |
| Molecular mass (g mol-1) | 339.32 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | 2-(4-mesyl-2-nitrobenzoyl)cyclohexane-1,3-dione |
| CAS name | 2-(4-(methylsulfonyl)-2-nitrobenzoyl)-1,3-cyclohexanedione |










Q:What products can SINO AGRO provide?