|
Still deciding? Get samples of $ !
Request Sample
|
| Customization: | Available |
|---|---|
| CAS No.: | 66230-04-4 |
| Formula: | C25h22clno3 |
Suppliers with verified business licenses
Audited by an independent third-party inspection agency
| Isomerism | A mixture of four stereoisomers (S,S-; R,S-; S,R-; R,R-) |
| Chemical formula | C25H22ClNO3 |
| Canonical SMILES | CC(C)C(C1=CC=C(C=C1)Cl)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3 |
| Isomeric SMILES | CC(C)[C@@H](C1=CC=C(C=C1)Cl)C(=O)O[C@H](C#N)C2=CC(=CC=C2)OC3=CC=CC=C3 |
| International Chemical Identifier key (InChIKey) | NYPJDWWKZLNGGM-RPWUZVMVSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3/t23-,24+/m0/s1 |
| Pesticide type | Insecticide |
| Substance group | Pyrethroid |
| Minimum active substance purity | 830 g/kg |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Contact and stomach action. Sodium channel modulator. |
| CAS RN | 66230-04-4 |
| EC number | - |
| CIPAC number | 481 |
| US EPA chemical code | 109303 |
| PubChem CID | 10342051 |
| Molecular mass (g mol-1) | 419.91 |
| PIN (Preferred Identification Name) | (S)-cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| IUPAC name | (S)-α-cyano-3-phenoxybenzyl (S)-2-(4-chlorophenyl)-3-methylbutyrate |
| CAS name | (S)-cyano(3-phenoxyphenyl)methyl (αS)-4-chloro-α-(1-methylethyl)benzeneacetate |
| Other status information | Severe Marine Pollutant |






Q:Is Sino Agro-Chemical Industry Ltd manufaturer or Trader?