Customization: | Available |
---|---|
CAS No.: | 98967-40-9 |
Formula: | C12h9f2n5o2s |
Still deciding? Get samples of $ !
Request Sample
|
Suppliers with verified business licenses
Audited by an independent third-party inspection agency
|
- | |
---|---|---|
|
C12H9F2N5O2S | |
|
CC1=NC2=NC(=NN2C=C1)S(=O)(=O)NC3=C(C=CC=C3F)F | |
|
No data | |
|
RXCPQSJAVKGONC-UHFFFAOYSA-N | |
|
InChI=1S/C12H9F2N5O2S/c1-7-5-6-19-11(15-7)16-12(17-19)22(20,21)18-10-8(13)3-2-4-9(10)14/h2-6,18H,1H3 |
|
Herbicide | |
---|---|---|
|
Cyclodiene | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic, absorbed by roots and leaves. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. | |
|
98967-40-9 | |
|
- | |
|
None allocated | |
|
129016 | |
|
91759 | |
|
325.29 | |
|
- | |
|
2',6'-difluoro-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonanilide | |
|
N-(2,6-difluorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |